cas: 143766-89-6 — see every product listed under this CAS number, including other names
N-Boc-Iminodipropionic acid 97% (CAS 143766-89-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A927943-100mg |
| cas | 143766-89-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 192.38 Pln | |
| Ambeed | 250mg | 248.00 Pln | |
| Ambeed | 1g | 431.56 Pln | |
| Ambeed | 5g | 971.12 Pln | |
| Ambeed | 10g | 1599.69 Pln | |
| Ambeed | 25g | 3129.38 Pln | |
| Ambeed | 100g | 9860.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A927943 |
3-[2-carboxyethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoic acid (CAS 143766-89-6) is a chemical compound with the molecular formula C11H19NO6 and a molecular weight of 261.27 g/mol. IUPAC name: 3-[2-carboxyethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoic acid. InChIKey: NIFJJASPEGEHDS-UHFFFAOYSA-N.
| Molecular formula | C11H19NO6 |
|---|---|
| Molecular weight | 261.27 g/mol |
| IUPAC name | 3-[2-carboxyethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoic acid |
| InChIKey | NIFJJASPEGEHDS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(CCC(=O)O)CCC(=O)O |
Computed by PubChem (NCBI)