cas: 72155-45-4 — see every product listed under this CAS number, including other names
N-Boc-L-phenylalaninal, 95% (CAS 72155-45-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F040933-250MG |
| cas | 72155-45-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 122.89 Pln | |
| Fluorochem | 1g | 221.81 Pln | |
| Fluorochem | 5g | 758.08 Pln | |
| Fluorochem | 10g | 1028.82 Pln | |
| Fluorochem | 25g | 2382.51 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
Tert-butyl N-[(2S)-1-oxo-3-phenylpropan-2-yl]carbamate (CAS 72155-45-4) is a chemical compound with the molecular formula C14H19NO3 and a molecular weight of 249.30 g/mol. IUPAC name: tert-butyl N-[(2S)-1-oxo-3-phenylpropan-2-yl]carbamate. InChIKey: ZJTYRNPLVNMVPQ-LBPRGKRZSA-N.
| Molecular formula | C14H19NO3 |
|---|---|
| Molecular weight | 249.30 g/mol |
| IUPAC name | tert-butyl N-[(2S)-1-oxo-3-phenylpropan-2-yl]carbamate |
| InChIKey | ZJTYRNPLVNMVPQ-LBPRGKRZSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC=CC=C1)C=O |
Computed by PubChem (NCBI)