CAS 59936-29-7 appears in our catalog under these names: Boc–L–Pro–OMe, Boc-L-Pro-OMe, N-Boc-L-proline methyl ester, 96% , N-(tert-Butoxycarbonyl)-L-proline Methyl Ester, >97.0%(GC), N-Boc-L-proline methyl ester. Offered by: GLPBio, Iris Biotech, Thermo Scientific (Alfa Aesar), TCI, Biosynth. Available pack sizes: 100g, 500g, 25g, 5g, 50g, 10g, 1000g, 25 g.
1-O-tert-butyl 2-O-methyl (2S)-pyrrolidine-1,2-dicarboxylate (CAS 59936-29-7) is a chemical compound with the molecular formula C11H19NO4 and a molecular weight of 229.27 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl (2S)-pyrrolidine-1,2-dicarboxylate. InChIKey: WVDGSSCWFMSRHN-QMMMGPOBSA-N.
| Molecular formula | C11H19NO4 |
|---|---|
| Molecular weight | 229.27 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl (2S)-pyrrolidine-1,2-dicarboxylate |
| InChIKey | WVDGSSCWFMSRHN-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1C(=O)OC |
Computed by PubChem (NCBI)