N-Boc-dolaproine dicyclohexylamine 98%
cas: 1369427-40-6 — see every product listed under this CAS number, including other names
N-Boc-dolaproine dicyclohexylamine 98% (CAS 1369427-40-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A802222-100mg |
| cas | 1369427-40-6 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 186.81 Pln | |
| Ambeed | 250mg | 236.88 Pln | |
| Ambeed | 1g | 509.44 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A802222 |
N-cyclohexylcyclohexanamine;(2R,3R)-3-methoxy-2-methyl-3-[(2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]propanoic acid (CAS 1369427-40-6) is a chemical compound with the molecular formula C26H48N2O5 and a molecular weight of 468.7 g/mol. IUPAC name: N-cyclohexylcyclohexanamine;(2R,3R)-3-methoxy-2-methyl-3-[(2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]propanoic acid. InChIKey: PKZALTWOMMNNOL-QJQMQQLTSA-N.
| Molecular formula | C26H48N2O5 |
|---|---|
| Molecular weight | 468.7 g/mol |
| IUPAC name | N-cyclohexylcyclohexanamine;(2R,3R)-3-methoxy-2-methyl-3-[(2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]propanoic acid |
| InChIKey | PKZALTWOMMNNOL-QJQMQQLTSA-N |
| SMILES | C[C@H]([C@H]([C@@H]1CCCN1C(=O)OC(C)(C)C)OC)C(=O)O.C1CCC(CC1)NC2CCCCC2 |
Computed by PubChem (NCBI)