cas: 6590-43-8 — see every product listed under this CAS number, including other names
N-Butyl-N-phenylbenzenamine, 95%+, 95%+ (CAS 6590-43-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12JEIR-100mg |
| cas | 6590-43-8 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 405.20 Pln | |
| Chemat | 250mg | 611.60 Pln | |
| Chemat | 1g | 1302.80 Pln |
| purity | 95%+ |
|---|---|
| delivery time | 3 weeks |
N-butyl-N-phenylaniline (CAS 6590-43-8) is a chemical compound with the molecular formula C16H19N and a molecular weight of 225.33 g/mol. IUPAC name: N-butyl-N-phenylaniline. InChIKey: SRENRFDRXNVMKN-UHFFFAOYSA-N.
| Molecular formula | C16H19N |
|---|---|
| Molecular weight | 225.33 g/mol |
| IUPAC name | N-butyl-N-phenylaniline |
| InChIKey | SRENRFDRXNVMKN-UHFFFAOYSA-N |
| SMILES | CCCCN(C1=CC=CC=C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)