cas: 137503-97-0 — see every product listed under this CAS number, including other names
N-Chloroacetyl-D-phenylalanine, 95%+, 95%+ (CAS 137503-97-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110GG3-250mg |
| cas | 137503-97-0 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 170.00 Pln | |
| Chemat | 1g | 237.20 Pln | |
| Chemat | 5g | 765.20 Pln | |
| Chemat | 10g | 1341.20 Pln |
| purity | 95%+ |
|---|---|
| delivery time | 3 weeks |
(2R)-2-[(2-chloroacetyl)amino]-3-phenylpropanoic acid (CAS 137503-97-0) is a chemical compound with the molecular formula C11H12ClNO3 and a molecular weight of 241.67 g/mol. IUPAC name: (2R)-2-[(2-chloroacetyl)amino]-3-phenylpropanoic acid. InChIKey: FUHGSOAURCZWCC-SECBINFHSA-N.
| Molecular formula | C11H12ClNO3 |
|---|---|
| Molecular weight | 241.67 g/mol |
| IUPAC name | (2R)-2-[(2-chloroacetyl)amino]-3-phenylpropanoic acid |
| InChIKey | FUHGSOAURCZWCC-SECBINFHSA-N |
| SMILES | C1=CC=C(C=C1)C[C@H](C(=O)O)NC(=O)CCl |
Computed by PubChem (NCBI)