CAS 183288-42-8 appears in our catalog under these names: Ethyl 5-aminobenzofuran-2-carboxylate hydrochloride, 95%, Ethyl 5-aminobenzofuran-2-carboxylate hydrochloride, 97%, Ethyl 5-aminobenzofuran-2-carboxylate hydrochloride, 98%, 98%, ETHYL 5-AMINOBENZOFURAN-2-CARBOXYLATE HCL, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 25g, 1g, 5g, 100mg, 10g, 250mg, 500mg.
Ethyl 5-amino-1-benzofuran-2-carboxylate;hydrochloride (CAS 183288-42-8) is a chemical compound with the molecular formula C11H12ClNO3 and a molecular weight of 241.67 g/mol. IUPAC name: ethyl 5-amino-1-benzofuran-2-carboxylate;hydrochloride. InChIKey: XGGIUALENXNONX-UHFFFAOYSA-N.
| Molecular formula | C11H12ClNO3 |
|---|---|
| Molecular weight | 241.67 g/mol |
| IUPAC name | ethyl 5-amino-1-benzofuran-2-carboxylate;hydrochloride |
| InChIKey | XGGIUALENXNONX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(O1)C=CC(=C2)N.Cl |
Computed by PubChem (NCBI)