Products 2183577-00-4
CAS 2183577-00-4 appears in our catalog under these names: 7-(2-Aminoethoxy)-2h-chromen-2-one hydrochloride, 95%, 7-(2-Aminoethoxy)-2H-chromen-2-one Hydrochloride, ≥95%, ≥95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 250mg, 10g, 5g, 1g.
7-(2-aminoethoxy)chromen-2-one;hydrochloride (CAS 2183577-00-4) is a chemical compound with the molecular formula C11H12ClNO3 and a molecular weight of 241.67 g/mol. IUPAC name: 7-(2-aminoethoxy)chromen-2-one;hydrochloride. InChIKey: VYZOEHADOQYBOP-UHFFFAOYSA-N.
| Molecular formula | C11H12ClNO3 |
|---|---|
| Molecular weight | 241.67 g/mol |
| IUPAC name | 7-(2-aminoethoxy)chromen-2-one;hydrochloride |
| InChIKey | VYZOEHADOQYBOP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=C1C=CC(=O)O2)OCCN.Cl |
Computed by PubChem (NCBI)