CAS 2241588-85-0 is the registry number for 2-Acetylamino-5-chloro-3-methyl-benzoic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 10g, 5g.
Methyl 2-acetamido-5-chloro-3-methylbenzoate (CAS 2241588-85-0) is a chemical compound with the molecular formula C11H12ClNO3 and a molecular weight of 241.67 g/mol. IUPAC name: methyl 2-acetamido-5-chloro-3-methylbenzoate. InChIKey: QESRLXMALOKRTH-UHFFFAOYSA-N.
| Molecular formula | C11H12ClNO3 |
|---|---|
| Molecular weight | 241.67 g/mol |
| IUPAC name | methyl 2-acetamido-5-chloro-3-methylbenzoate |
| InChIKey | QESRLXMALOKRTH-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1NC(=O)C)C(=O)OC)Cl |
Computed by PubChem (NCBI)