cas: 871269-10-2 — see every product listed under this CAS number, including other names
N-Cyclohexyl 3-bromobenzenesulfonamide 98% (CAS 871269-10-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A638364-1g |
| cas | 871269-10-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 275.81 Pln | |
| Ambeed | 5g | 776.44 Pln | |
| Ambeed | 25g | 2534.19 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A638364 |
3-bromo-N-cyclohexylbenzenesulfonamide (CAS 871269-10-2) is a chemical compound with the molecular formula C12H16BrNO2S and a molecular weight of 318.23 g/mol. IUPAC name: 3-bromo-N-cyclohexylbenzenesulfonamide. InChIKey: MLUYYAINRSPCFT-UHFFFAOYSA-N.
| Molecular formula | C12H16BrNO2S |
|---|---|
| Molecular weight | 318.23 g/mol |
| IUPAC name | 3-bromo-N-cyclohexylbenzenesulfonamide |
| InChIKey | MLUYYAINRSPCFT-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)NS(=O)(=O)C2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)