cas: 95-33-0 — see every product listed under this CAS number, including other names
N-Cyclohexyl-2-Benzothiazolesulfenamide, 95%, 95% (CAS 95-33-0) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114SX1-25g |
| cas | 95-33-0 |
| size | 25g |
| availability | 800g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25g | 74.00 Pln | |
| Chemat | 100g | 141.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
N-(1,3-benzothiazol-2-ylsulfanyl)cyclohexanamine (CAS 95-33-0) is a chemical compound with the molecular formula C13H16N2S2 and a molecular weight of 264.4 g/mol. IUPAC name: N-(1,3-benzothiazol-2-ylsulfanyl)cyclohexanamine. InChIKey: DEQZTKGFXNUBJL-UHFFFAOYSA-N.
| Molecular formula | C13H16N2S2 |
|---|---|
| Molecular weight | 264.4 g/mol |
| IUPAC name | N-(1,3-benzothiazol-2-ylsulfanyl)cyclohexanamine |
| InChIKey | DEQZTKGFXNUBJL-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)NSC2=NC3=CC=CC=C3S2 |
Computed by PubChem (NCBI)