cas: 95-33-0 — see every product listed under this CAS number, including other names
Thiohexam 95% (CAS 95-33-0) is a chemical reagent available from Chemat. Available pack sizes: 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A409501-100g |
| cas | 95-33-0 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100g | 203.50 Pln | |
| Ambeed | 500g | 414.88 Pln | |
| Ambeed | 1000g | 648.50 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A409501 |
N-(1,3-benzothiazol-2-ylsulfanyl)cyclohexanamine (CAS 95-33-0) is a chemical compound with the molecular formula C13H16N2S2 and a molecular weight of 264.4 g/mol. IUPAC name: N-(1,3-benzothiazol-2-ylsulfanyl)cyclohexanamine. InChIKey: DEQZTKGFXNUBJL-UHFFFAOYSA-N.
| Molecular formula | C13H16N2S2 |
|---|---|
| Molecular weight | 264.4 g/mol |
| IUPAC name | N-(1,3-benzothiazol-2-ylsulfanyl)cyclohexanamine |
| InChIKey | DEQZTKGFXNUBJL-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)NSC2=NC3=CC=CC=C3S2 |
Computed by PubChem (NCBI)