Thiohexam, 99.87%
cas: 95-33-0 — see every product listed under this CAS number, including other names
Thiohexam, 99.87% (CAS 95-33-0) is a chemical reagent available from Chemat. Available pack sizes: 5 g, 10 g, 100 mg, 1 g, 500 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W020755-5 g |
| cas | 95-33-0 |
| size | 5 g |
| availability | In stock |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 5 g | 505.45 Pln | |
| MedChemExpress | 10 g | 695.86 Pln | |
| MedChemExpress | 100 mg | 240.74 Pln | |
| MedChemExpress | 1 g | 310.40 Pln | |
| MedChemExpress | 500 mg | 263.96 Pln |
properties
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.87% |
N-(1,3-benzothiazol-2-ylsulfanyl)cyclohexanamine (CAS 95-33-0) is a chemical compound with the molecular formula C13H16N2S2 and a molecular weight of 264.4 g/mol. IUPAC name: N-(1,3-benzothiazol-2-ylsulfanyl)cyclohexanamine. InChIKey: DEQZTKGFXNUBJL-UHFFFAOYSA-N.
| Molecular formula | C13H16N2S2 |
|---|---|
| Molecular weight | 264.4 g/mol |
| IUPAC name | N-(1,3-benzothiazol-2-ylsulfanyl)cyclohexanamine |
| InChIKey | DEQZTKGFXNUBJL-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)NSC2=NC3=CC=CC=C3S2 |
Computed by PubChem (NCBI)
Synonyms:
Thiohexam, Vulkacit CZ, Santocure, Sulfenax, Sulfenamide Ts, Accelerator CZ, Curax, Durax, Santocure Powder, Sulfenax TsB