cas: 95-33-0 — see every product listed under this CAS number, including other names
Thiohexam, 98% (CAS 95-33-0) is a chemical reagent available from Chemat. Available pack sizes: 100g, 500g, 1kg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F986813-100G |
| cas | 95-33-0 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100g | 96.86 Pln | |
| Fluorochem | 500g | 247.85 Pln | |
| Fluorochem | 1kg | 435.28 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
N-(1,3-benzothiazol-2-ylsulfanyl)cyclohexanamine (CAS 95-33-0) is a chemical compound with the molecular formula C13H16N2S2 and a molecular weight of 264.4 g/mol. IUPAC name: N-(1,3-benzothiazol-2-ylsulfanyl)cyclohexanamine. InChIKey: DEQZTKGFXNUBJL-UHFFFAOYSA-N.
| Molecular formula | C13H16N2S2 |
|---|---|
| Molecular weight | 264.4 g/mol |
| IUPAC name | N-(1,3-benzothiazol-2-ylsulfanyl)cyclohexanamine |
| InChIKey | DEQZTKGFXNUBJL-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)NSC2=NC3=CC=CC=C3S2 |
Computed by PubChem (NCBI)