cas: 401589-92-2 — see every product listed under this CAS number, including other names
N-Cyclopropyl 3-nitrobenzenesulfonamide, 95%, 95% (CAS 401589-92-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114SXJ-5g |
| cas | 401589-92-2 |
| size | 5g |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 400.40 Pln | |
| Chemat | 10g | 544.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
N-cyclopropyl-3-nitrobenzenesulfonamide (CAS 401589-92-2) is a chemical compound with the molecular formula C9H10N2O4S and a molecular weight of 242.25 g/mol. IUPAC name: N-cyclopropyl-3-nitrobenzenesulfonamide. InChIKey: MHHCAIGIVXSRPA-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O4S |
|---|---|
| Molecular weight | 242.25 g/mol |
| IUPAC name | N-cyclopropyl-3-nitrobenzenesulfonamide |
| InChIKey | MHHCAIGIVXSRPA-UHFFFAOYSA-N |
| SMILES | C1CC1NS(=O)(=O)C2=CC=CC(=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)