cas: 177785-41-0 — see every product listed under this CAS number, including other names
N-Cyclopropyl 4-Aminophenylsulfonamide, 97%, 97% (CAS 177785-41-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1136JF-100mg |
| cas | 177785-41-0 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 112.40 Pln | |
| Chemat | 250mg | 141.20 Pln | |
| Chemat | 1g | 275.60 Pln | |
| Chemat | 5g | 736.40 Pln | |
| Chemat | 10g | 1326.80 Pln | |
| Chemat | 25g | 2522.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-amino-N-cyclopropylbenzenesulfonamide (CAS 177785-41-0) is a chemical compound with the molecular formula C9H12N2O2S and a molecular weight of 212.27 g/mol. IUPAC name: 4-amino-N-cyclopropylbenzenesulfonamide. InChIKey: KOLXPLAKQKRJLH-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O2S |
|---|---|
| Molecular weight | 212.27 g/mol |
| IUPAC name | 4-amino-N-cyclopropylbenzenesulfonamide |
| InChIKey | KOLXPLAKQKRJLH-UHFFFAOYSA-N |
| SMILES | C1CC1NS(=O)(=O)C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)