cas: 549476-61-1 — see every product listed under this CAS number, including other names
N-Cyclopropyl 4-Nitrophenylsulfonamide, 97%, 97% (CAS 549476-61-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114SXL-100mg |
| cas | 549476-61-1 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 155.60 Pln | |
| Chemat | 250mg | 170.00 Pln | |
| Chemat | 1g | 208.40 Pln | |
| Chemat | 5g | 429.20 Pln | |
| Chemat | 10g | 702.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
N-cyclopropyl-4-nitrobenzenesulfonamide (CAS 549476-61-1) is a chemical compound with the molecular formula C9H10N2O4S and a molecular weight of 242.25 g/mol. IUPAC name: N-cyclopropyl-4-nitrobenzenesulfonamide. InChIKey: SFXOKDPLGLHGIX-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O4S |
|---|---|
| Molecular weight | 242.25 g/mol |
| IUPAC name | N-cyclopropyl-4-nitrobenzenesulfonamide |
| InChIKey | SFXOKDPLGLHGIX-UHFFFAOYSA-N |
| SMILES | C1CC1NS(=O)(=O)C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)