cas: 1234988-79-4 — see every product listed under this CAS number, including other names
N-Ethyl-4-(dimethylamino)benzylamine DiHCl, ≥95%, ≥95% (CAS 1234988-79-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111KOD-1g |
| cas | 1234988-79-4 |
| size | 1g |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 419.60 Pln | |
| Chemat | 5g | 986.00 Pln | |
| Chemat | 25g | 3894.80 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
4-(ethylaminomethyl)-N,N-dimethylaniline;dihydrochloride (CAS 1234988-79-4) is a chemical compound with the molecular formula C11H20Cl2N2 and a molecular weight of 251.19 g/mol. IUPAC name: 4-(ethylaminomethyl)-N,N-dimethylaniline;dihydrochloride. InChIKey: BCOVXMVBBIBVAR-UHFFFAOYSA-N.
| Molecular formula | C11H20Cl2N2 |
|---|---|
| Molecular weight | 251.19 g/mol |
| IUPAC name | 4-(ethylaminomethyl)-N,N-dimethylaniline;dihydrochloride |
| InChIKey | BCOVXMVBBIBVAR-UHFFFAOYSA-N |
| SMILES | CCNCC1=CC=C(C=C1)N(C)C.Cl.Cl |
Computed by PubChem (NCBI)