CAS 1269394-33-3 appears in our catalog under these names: N1,N1-Dimethyl-1-(3-methylphenyl)-1,2-ethanediamine dihydrochloride, 95%, N1,N1-Dimethyl-1-(m-tolyl)ethane-1,2-diamine dihydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
N,N-dimethyl-1-(3-methylphenyl)ethane-1,2-diamine;dihydrochloride (CAS 1269394-33-3) is a chemical compound with the molecular formula C11H20Cl2N2 and a molecular weight of 251.19 g/mol. IUPAC name: N,N-dimethyl-1-(3-methylphenyl)ethane-1,2-diamine;dihydrochloride. InChIKey: VOSNNWNFBWMPDL-UHFFFAOYSA-N.
| Molecular formula | C11H20Cl2N2 |
|---|---|
| Molecular weight | 251.19 g/mol |
| IUPAC name | N,N-dimethyl-1-(3-methylphenyl)ethane-1,2-diamine;dihydrochloride |
| InChIKey | VOSNNWNFBWMPDL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C(CN)N(C)C.Cl.Cl |
Computed by PubChem (NCBI)