CAS 55875-55-3 is the registry number for 4-(2-Aminopropyl)-N,N-dimethylaniline dihydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-(2-aminopropyl)-N,N-dimethylaniline;dihydrochloride (CAS 55875-55-3) is a chemical compound with the molecular formula C11H20Cl2N2 and a molecular weight of 251.19 g/mol. IUPAC name: 4-(2-aminopropyl)-N,N-dimethylaniline;dihydrochloride. InChIKey: NWQNCALMMPMUFF-UHFFFAOYSA-N.
| Molecular formula | C11H20Cl2N2 |
|---|---|
| Molecular weight | 251.19 g/mol |
| IUPAC name | 4-(2-aminopropyl)-N,N-dimethylaniline;dihydrochloride |
| InChIKey | NWQNCALMMPMUFF-UHFFFAOYSA-N |
| SMILES | CC(CC1=CC=C(C=C1)N(C)C)N.Cl.Cl |
Computed by PubChem (NCBI)