CAS 329185-37-7 is the registry number for 4-(1,1-Dimethylethyl)-2-Pyridineethanamine dihydrochloride. Offered by: TRC. Available pack sizes: 500mg.
2-(4-tert-butyl-2-pyridinyl)ethanamine;dihydrochloride (CAS 329185-37-7) is a chemical compound with the molecular formula C11H20Cl2N2 and a molecular weight of 251.19 g/mol. IUPAC name: 2-(4-tert-butyl-2-pyridinyl)ethanamine;dihydrochloride. InChIKey: XVNSIOGKSCLFBU-UHFFFAOYSA-N.
| Molecular formula | C11H20Cl2N2 |
|---|---|
| Molecular weight | 251.19 g/mol |
| IUPAC name | 2-(4-tert-butyl-2-pyridinyl)ethanamine;dihydrochloride |
| InChIKey | XVNSIOGKSCLFBU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=NC=C1)CCN.Cl.Cl |
Computed by PubChem (NCBI)