cas: 88050-17-3 — see every product listed under this CAS number, including other names
N-Fmoc-trans-4-Hydroxy-L-proline, 98%, 98% (CAS 88050-17-3) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 100g, 250g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1145Y3-10g |
| cas | 88050-17-3 |
| size | 10g |
| availability | 549.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 74.00 Pln | |
| Chemat | 25g | 93.20 Pln | |
| Chemat | 100g | 170.00 Pln | |
| Chemat | 250g | 333.20 Pln | |
| Chemat | 500g | 676.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S,4R)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-hydroxypyrrolidine-2-carboxylic acid (CAS 88050-17-3) is a chemical compound with the molecular formula C20H19NO5 and a molecular weight of 353.4 g/mol. IUPAC name: (2S,4R)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-hydroxypyrrolidine-2-carboxylic acid. InChIKey: GOUUPUICWUFXPM-XIKOKIGWSA-N.
| Molecular formula | C20H19NO5 |
|---|---|
| Molecular weight | 353.4 g/mol |
| IUPAC name | (2S,4R)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-hydroxypyrrolidine-2-carboxylic acid |
| InChIKey | GOUUPUICWUFXPM-XIKOKIGWSA-N |
| SMILES | C1[C@H](CN([C@@H]1C(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)O |
Computed by PubChem (NCBI)