cas: 89840-80-2 — see every product listed under this CAS number, including other names
N-Isobutyl-4-nitrobenzenesulfonamide, 97% (CAS 89840-80-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 2.5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F555966-100MG |
| cas | 89840-80-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 456.11 Pln | |
| Fluorochem | 250mg | 633.13 Pln | |
| Fluorochem | 1g | 1632.78 Pln | |
| Fluorochem | 2.5g | 3205.14 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
N-(2-methylpropyl)-4-nitrobenzenesulfonamide (CAS 89840-80-2) is a chemical compound with the molecular formula C10H14N2O4S and a molecular weight of 258.30 g/mol. IUPAC name: N-(2-methylpropyl)-4-nitrobenzenesulfonamide. InChIKey: QIEVLZQUEZLVSY-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O4S |
|---|---|
| Molecular weight | 258.30 g/mol |
| IUPAC name | N-(2-methylpropyl)-4-nitrobenzenesulfonamide |
| InChIKey | QIEVLZQUEZLVSY-UHFFFAOYSA-N |
| SMILES | CC(C)CNS(=O)(=O)C1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)