cas: 1595290-47-3 — see every product listed under this CAS number, including other names
N-Isopropyl-2-(3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy)acetamide 95+% (CAS 1595290-47-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A556288-100mg |
| cas | 1595290-47-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 526.12 Pln | |
| Ambeed | 250mg | 854.31 Pln | |
| Ambeed | 1g | 1065.69 Pln | |
| Ambeed | 5g | 5042.88 Pln |
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A556288 |
N-propan-2-yl-2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]acetamide (CAS 1595290-47-3) is a chemical compound with the molecular formula C17H26BNO4 and a molecular weight of 319.2 g/mol. IUPAC name: N-propan-2-yl-2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]acetamide. InChIKey: RHGYOLJSJSOEMH-UHFFFAOYSA-N.
| Molecular formula | C17H26BNO4 |
|---|---|
| Molecular weight | 319.2 g/mol |
| IUPAC name | N-propan-2-yl-2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]acetamide |
| InChIKey | RHGYOLJSJSOEMH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)OCC(=O)NC(C)C |
Computed by PubChem (NCBI)