cas: 1197171-76-8 — see every product listed under this CAS number, including other names
N-Methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide, 98%, 98% (CAS 1197171-76-8) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111PHX-500mg |
| cas | 1197171-76-8 |
| size | 500mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 500mg | 246.80 Pln | |
| Chemat | 250mg | 155.60 Pln | |
| Chemat | 1g | 290.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
N-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide (CAS 1197171-76-8) is a chemical compound with the molecular formula C14H20BNO3 and a molecular weight of 261.13 g/mol. IUPAC name: N-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide. InChIKey: YKVCWFPOJAXHGE-UHFFFAOYSA-N.
| Molecular formula | C14H20BNO3 |
|---|---|
| Molecular weight | 261.13 g/mol |
| IUPAC name | N-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
| InChIKey | YKVCWFPOJAXHGE-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)C(=O)NC |
Computed by PubChem (NCBI)