cas: 1073353-47-5 — see every product listed under this CAS number, including other names
N-Methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide, 98% (CAS 1073353-47-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F447530-1G |
| cas | 1073353-47-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 445.69 Pln | |
| Fluorochem | 5g | 1747.32 Pln | |
| Fluorochem | 10g | 2486.64 Pln | |
| Fluorochem | 25g | 5188.82 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
N-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide (CAS 1073353-47-5) is a chemical compound with the molecular formula C13H20BNO4S and a molecular weight of 297.2 g/mol. IUPAC name: N-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide. InChIKey: CLGYHPYEQCQBDA-UHFFFAOYSA-N.
| Molecular formula | C13H20BNO4S |
|---|---|
| Molecular weight | 297.2 g/mol |
| IUPAC name | N-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide |
| InChIKey | CLGYHPYEQCQBDA-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)S(=O)(=O)NC |
Computed by PubChem (NCBI)