cas: 6319-45-5 — see every product listed under this CAS number, including other names
N-Methyl-4-nitrobenzenesulfonamide (CAS 6319-45-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F239267-1G |
| cas | 6319-45-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 221.81 Pln | |
| Fluorochem | 5g | 471.73 Pln | |
| Fluorochem | 25g | 1476.58 Pln | |
| Fluorochem | 100g | 3902.81 Pln |
| delivery time | 2-3 weeks |
|---|
N-methyl-4-nitrobenzenesulfonamide (CAS 6319-45-5) is a chemical compound with the molecular formula C7H8N2O4S and a molecular weight of 216.22 g/mol. IUPAC name: N-methyl-4-nitrobenzenesulfonamide. InChIKey: IHIJFQRUYCEKCZ-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O4S |
|---|---|
| Molecular weight | 216.22 g/mol |
| IUPAC name | N-methyl-4-nitrobenzenesulfonamide |
| InChIKey | IHIJFQRUYCEKCZ-UHFFFAOYSA-N |
| SMILES | CNS(=O)(=O)C1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)