CAS 76338-73-3 appears in our catalog under these names: 2-{(2-Chloro-4-(trifluoromethyl)phenyl)amino}-3-methylbutanoic acid, 2-{[2-Chloro-4-(Trifluoromethyl)Phenyl]Amino}-3-Methylbutanoic Acid, 95%, 95%, 2-{[2-chloro-4-(trifluoromethyl)phenyl]amino}-3-methylbutanoic acid, 95%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 2,5g, 100mg, 1g, 5g.
2-[2-chloro-4-(trifluoromethyl)anilino]-3-methylbutanoic acid (CAS 76338-73-3) is a chemical compound with the molecular formula C12H13ClF3NO2 and a molecular weight of 295.68 g/mol. IUPAC name: 2-[2-chloro-4-(trifluoromethyl)anilino]-3-methylbutanoic acid. InChIKey: YKSHSSFDOHACTC-UHFFFAOYSA-N.
| Molecular formula | C12H13ClF3NO2 |
|---|---|
| Molecular weight | 295.68 g/mol |
| IUPAC name | 2-[2-chloro-4-(trifluoromethyl)anilino]-3-methylbutanoic acid |
| InChIKey | YKSHSSFDOHACTC-UHFFFAOYSA-N |
| SMILES | CC(C)C(C(=O)O)NC1=C(C=C(C=C1)C(F)(F)F)Cl |
Computed by PubChem (NCBI)