Products 606129-50-4
CAS 606129-50-4 is the registry number for 3-(4-Chlorobenzyl)azetidine 2,2,2-trifluoroacetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[(4-chlorophenyl)methyl]azetidine;2,2,2-trifluoroacetic acid (CAS 606129-50-4) is a chemical compound with the molecular formula C12H13ClF3NO2 and a molecular weight of 295.68 g/mol. IUPAC name: 3-[(4-chlorophenyl)methyl]azetidine;2,2,2-trifluoroacetic acid. InChIKey: VIKRMPBDRYZBCL-UHFFFAOYSA-N.
| Molecular formula | C12H13ClF3NO2 |
|---|---|
| Molecular weight | 295.68 g/mol |
| IUPAC name | 3-[(4-chlorophenyl)methyl]azetidine;2,2,2-trifluoroacetic acid |
| InChIKey | VIKRMPBDRYZBCL-UHFFFAOYSA-N |
| SMILES | C1C(CN1)CC2=CC=C(C=C2)Cl.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)