CAS 1049978-65-5 appears in our catalog under these names: Trans-4-(3-(trifluoromethyl)phenyl)pyrrolidine-3-carboxylic acid hydrochloride, 95%, (3S,4R)-4-(3-(Trifluoromethyl)phenyl)pyrrolidine-3-carboxylic acid hydrochloride, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 5g, 250mg, 1g, 100mg.
(3S,4R)-4-[3-(trifluoromethyl)phenyl]pyrrolidine-3-carboxylic acid;hydrochloride (CAS 1049978-65-5) is a chemical compound with the molecular formula C12H13ClF3NO2 and a molecular weight of 295.68 g/mol. IUPAC name: (3S,4R)-4-[3-(trifluoromethyl)phenyl]pyrrolidine-3-carboxylic acid;hydrochloride. InChIKey: QDRXDKSFBQDVPX-BAUSSPIASA-N.
| Molecular formula | C12H13ClF3NO2 |
|---|---|
| Molecular weight | 295.68 g/mol |
| IUPAC name | (3S,4R)-4-[3-(trifluoromethyl)phenyl]pyrrolidine-3-carboxylic acid;hydrochloride |
| InChIKey | QDRXDKSFBQDVPX-BAUSSPIASA-N |
| SMILES | C1[C@H]([C@@H](CN1)C(=O)O)C2=CC(=CC=C2)C(F)(F)F.Cl |
Computed by PubChem (NCBI)