Products 2098497-09-5
CAS 2098497-09-5 is the registry number for (S，E)–Methyl 2–amino–4–(4–(trifluoromethyl)phenyl)but–3–enoate hydrochloride. Offered by: GLPBio. Available pack sizes: 100mg, 250mg.
Methyl (E,2S)-2-amino-4-[4-(trifluoromethyl)phenyl]but-3-enoate;hydrochloride (CAS 2098497-09-5) is a chemical compound with the molecular formula C12H13ClF3NO2 and a molecular weight of 295.68 g/mol. IUPAC name: methyl (E,2S)-2-amino-4-[4-(trifluoromethyl)phenyl]but-3-enoate;hydrochloride. InChIKey: UUDUQHBJJVCBRU-SZZWBKDQSA-N.
| Molecular formula | C12H13ClF3NO2 |
|---|---|
| Molecular weight | 295.68 g/mol |
| IUPAC name | methyl (E,2S)-2-amino-4-[4-(trifluoromethyl)phenyl]but-3-enoate;hydrochloride |
| InChIKey | UUDUQHBJJVCBRU-SZZWBKDQSA-N |
| SMILES | COC(=O)[C@H](/C=C/C1=CC=C(C=C1)C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)