cas: 3278-14-6 — see every product listed under this CAS number, including other names
N-Phenethylbenzamide, 95% (CAS 3278-14-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F463414-1G |
| cas | 3278-14-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 112.48 Pln | |
| Fluorochem | 25g | 174.96 Pln | |
| Fluorochem | 100g | 544.62 Pln | |
| Fluorochem | 500g | 1362.04 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
N-(2-phenylethyl)benzamide (CAS 3278-14-6) is a chemical compound with the molecular formula C15H15NO and a molecular weight of 225.28 g/mol. IUPAC name: N-(2-phenylethyl)benzamide. InChIKey: DAVRGGJTJDTVQT-UHFFFAOYSA-N.
| Molecular formula | C15H15NO |
|---|---|
| Molecular weight | 225.28 g/mol |
| IUPAC name | N-(2-phenylethyl)benzamide |
| InChIKey | DAVRGGJTJDTVQT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCNC(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)