cas: 3278-14-6 — see every product listed under this CAS number, including other names
N-Phenethylbenzamide, 99.86% (CAS 3278-14-6) is a chemical reagent available from Chemat. Available pack sizes: 5 g, 25 g, 10mM/1mL, 10 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-32135-5 g |
| cas | 3278-14-6 |
| size | 5 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 5 g | 375.42 Pln | |
| MedChemExpress | 25 g | 881.62 Pln | |
| MedChemExpress | 10mM/1mL | 398.64 Pln | |
| MedChemExpress | 10 g | 500.81 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.86% |
N-(2-phenylethyl)benzamide (CAS 3278-14-6) is a chemical compound with the molecular formula C15H15NO and a molecular weight of 225.28 g/mol. IUPAC name: N-(2-phenylethyl)benzamide. InChIKey: DAVRGGJTJDTVQT-UHFFFAOYSA-N.
| Molecular formula | C15H15NO |
|---|---|
| Molecular weight | 225.28 g/mol |
| IUPAC name | N-(2-phenylethyl)benzamide |
| InChIKey | DAVRGGJTJDTVQT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCNC(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)