N-Phenylpiperazine-1-carboxamide, 98%
cas: 115994-87-1 — see every product listed under this CAS number, including other names
N-Phenylpiperazine-1-carboxamide, 98% (CAS 115994-87-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg, 5g, 10g, 25g, 100g. Offered by: AmBeed, Fluorochem, Chemat.
| brand | AmBeed |
|---|---|
| catalog number | A865684-250mg |
| cas | 115994-87-1 |
| size | 250mg |
| availability | Synthetic Items: 0g |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| AmBeed | 250mg | 532.21 Pln | |
| AmBeed | 1g | 629.86 Pln | |
| Fluorochem | 100mg | 164.54 Pln | |
| Fluorochem | 250mg | 216.61 Pln | |
| Fluorochem | 1g | 424.87 Pln | |
| Fluorochem | 5g | 1143.37 Pln | |
| Fluorochem | 10g | 1841.04 Pln | |
| Fluorochem | 25g | 3585.21 Pln | |
| Fluorochem | 100g | 9463.35 Pln | |
| Chemat | 100mg | 107.60 Pln | |
| Chemat | 250mg | 141.20 Pln | |
| Chemat | 1g | 270.80 Pln | |
| Chemat | 5g | 846.80 Pln | |
| Chemat | 10g | 1398.80 Pln | |
| Chemat | 25g | 2733.20 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
N-phenylpiperazine-1-carboxamide (CAS 115994-87-1) is a chemical compound with the molecular formula C11H15N3O and a molecular weight of 205.26 g/mol. IUPAC name: N-phenylpiperazine-1-carboxamide. InChIKey: YEQDVKYOHVLZPU-UHFFFAOYSA-N.
| Molecular formula | C11H15N3O |
|---|---|
| Molecular weight | 205.26 g/mol |
| IUPAC name | N-phenylpiperazine-1-carboxamide |
| InChIKey | YEQDVKYOHVLZPU-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C(=O)NC2=CC=CC=C2 |
Computed by PubChem (NCBI)