cas: 115994-87-1 — see every product listed under this CAS number, including other names
N-Phenylpiperazine-1-carboxamide, 98% (CAS 115994-87-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg, 5g, 10g, 25g, 100g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A865684-250mg |
| cas | 115994-87-1 |
| size | 250mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 250mg | 532.21 Pln | |
| AmBeed | 1g | 629.86 Pln | |
| Fluorochem | 100mg | 154.13 Pln | |
| Fluorochem | 250mg | 206.20 Pln | |
| Fluorochem | 1g | 404.04 Pln | |
| Fluorochem | 5g | 1091.30 Pln | |
| Fluorochem | 10g | 1768.15 Pln | |
| Fluorochem | 25g | 3475.88 Pln | |
| Fluorochem | 100g | 9369.64 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
N-phenylpiperazine-1-carboxamide (CAS 115994-87-1) is a chemical compound with the molecular formula C11H15N3O and a molecular weight of 205.26 g/mol. IUPAC name: N-phenylpiperazine-1-carboxamide. InChIKey: YEQDVKYOHVLZPU-UHFFFAOYSA-N.
| Molecular formula | C11H15N3O |
|---|---|
| Molecular weight | 205.26 g/mol |
| IUPAC name | N-phenylpiperazine-1-carboxamide |
| InChIKey | YEQDVKYOHVLZPU-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C(=O)NC2=CC=CC=C2 |
Computed by PubChem (NCBI)