Products 702638-74-2
CAS 702638-74-2 appears in our catalog under these names: N-(3-Aminophenyl)pyrrolidine-1-carboxamide, 95%, N-(3-Aminophenyl)pyrrolidine-1-carboxamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 100mg.
N-(3-aminophenyl)pyrrolidine-1-carboxamide (CAS 702638-74-2) is a chemical compound with the molecular formula C11H15N3O and a molecular weight of 205.26 g/mol. IUPAC name: N-(3-aminophenyl)pyrrolidine-1-carboxamide. InChIKey: ZXTAQMNPVKRVFU-UHFFFAOYSA-N.
| Molecular formula | C11H15N3O |
|---|---|
| Molecular weight | 205.26 g/mol |
| IUPAC name | N-(3-aminophenyl)pyrrolidine-1-carboxamide |
| InChIKey | ZXTAQMNPVKRVFU-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)C(=O)NC2=CC=CC(=C2)N |
Computed by PubChem (NCBI)