Products 710322-81-9
CAS 710322-81-9 appears in our catalog under these names: N-(5-Ethenyl-2-pyrazinyl)-2,2-dimethyl-propanamide, 95%, N-(5-Vinylpyrazin-2-yl)pivalamide, 97% mix TBC as stabilizer, N–(5–vinylpyrazin–2–yl)pivalamide. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 1g, 5g, 250mg, 100mg.
N-(5-ethenylpyrazin-2-yl)-2,2-dimethylpropanamide (CAS 710322-81-9) is a chemical compound with the molecular formula C11H15N3O and a molecular weight of 205.26 g/mol. IUPAC name: N-(5-ethenylpyrazin-2-yl)-2,2-dimethylpropanamide. InChIKey: VCMQLZVEZWPHHH-UHFFFAOYSA-N.
| Molecular formula | C11H15N3O |
|---|---|
| Molecular weight | 205.26 g/mol |
| IUPAC name | N-(5-ethenylpyrazin-2-yl)-2,2-dimethylpropanamide |
| InChIKey | VCMQLZVEZWPHHH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=NC=C(N=C1)C=C |
Computed by PubChem (NCBI)