CAS 1822685-93-7 is the registry number for 1-(Butan-2-yl)-4-methyl-1h,2h,6h-pyrazolo[3,4-b]pyridin-6-one, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
1-butan-2-yl-4-methyl-7H-pyrazolo[5,4-b]pyridin-6-one (CAS 1822685-93-7) is a chemical compound with the molecular formula C11H15N3O and a molecular weight of 205.26 g/mol. IUPAC name: 1-butan-2-yl-4-methyl-7H-pyrazolo[5,4-b]pyridin-6-one. InChIKey: BLWGJZHWFQZNJY-UHFFFAOYSA-N.
| Molecular formula | C11H15N3O |
|---|---|
| Molecular weight | 205.26 g/mol |
| IUPAC name | 1-butan-2-yl-4-methyl-7H-pyrazolo[5,4-b]pyridin-6-one |
| InChIKey | BLWGJZHWFQZNJY-UHFFFAOYSA-N |
| SMILES | CCC(C)N1C2=C(C=N1)C(=CC(=O)N2)C |
Computed by PubChem (NCBI)