cas: 5024-68-0 — see every product listed under this CAS number, including other names
N-Phenylpyridin-3-amine, 95+% (CAS 5024-68-0) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A231325-10g |
| cas | 5024-68-0 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 22158.43 Pln | |
| AmBeed | 25g | 43485.19 Pln | |
| AmBeed | 5g | 13103.02 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
N-phenylpyridin-3-amine (CAS 5024-68-0) is a chemical compound with the molecular formula C11H10N2 and a molecular weight of 170.21 g/mol. IUPAC name: N-phenylpyridin-3-amine. InChIKey: JNYYORRROUFDBG-UHFFFAOYSA-N.
| Molecular formula | C11H10N2 |
|---|---|
| Molecular weight | 170.21 g/mol |
| IUPAC name | N-phenylpyridin-3-amine |
| InChIKey | JNYYORRROUFDBG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=CN=CC=C2 |
Computed by PubChem (NCBI)