cas: 1860028-27-8 — see every product listed under this CAS number, including other names
N-cyclopropyl-1H-indole-5-sulfonamide, 96%, 96% (CAS 1860028-27-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IKRZ-250mg |
| cas | 1860028-27-8 |
| size | 250mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 448.40 Pln | |
| Chemat | 500mg | 803.60 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
N-cyclopropyl-1H-indole-5-sulfonamide (CAS 1860028-27-8) is a chemical compound with the molecular formula C11H12N2O2S and a molecular weight of 236.29 g/mol. IUPAC name: N-cyclopropyl-1H-indole-5-sulfonamide. InChIKey: IPASSHAGIYIZJN-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O2S |
|---|---|
| Molecular weight | 236.29 g/mol |
| IUPAC name | N-cyclopropyl-1H-indole-5-sulfonamide |
| InChIKey | IPASSHAGIYIZJN-UHFFFAOYSA-N |
| SMILES | C1CC1NS(=O)(=O)C2=CC3=C(C=C2)NC=C3 |
Computed by PubChem (NCBI)