CAS 103188-48-3 appears in our catalog under these names: N-trans-caffeoyltyramine/ 99.85% (existing batch purity), N–trans–Caffeoyltyramine, Typheramide, (E)-3-(3,4-Dihydroxyphenyl)-N-(4-hydroxyphenethyl)acrylamide, 98%, 98%, N-trans-Caffeoyltyramine, 99.72%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 2mg, 250mg.
(E)-3-(3,4-dihydroxyphenyl)-N-[2-(4-hydroxyphenyl)ethyl]prop-2-enamide (CAS 103188-48-3) is a chemical compound with the molecular formula C17H17NO4 and a molecular weight of 299.32 g/mol. IUPAC name: (E)-3-(3,4-dihydroxyphenyl)-N-[2-(4-hydroxyphenyl)ethyl]prop-2-enamide. InChIKey: VSHUQLRHTJOKTA-XBXARRHUSA-N.
| Molecular formula | C17H17NO4 |
|---|---|
| Molecular weight | 299.32 g/mol |
| IUPAC name | (E)-3-(3,4-dihydroxyphenyl)-N-[2-(4-hydroxyphenyl)ethyl]prop-2-enamide |
| InChIKey | VSHUQLRHTJOKTA-XBXARRHUSA-N |
| SMILES | C1=CC(=CC=C1CCNC(=O)/C=C/C2=CC(=C(C=C2)O)O)O |
Computed by PubChem (NCBI)