cas: 1269394-33-3 — see every product listed under this CAS number, including other names
N1,N1-Dimethyl-1-(m-tolyl)ethane-1,2-diamine dihydrochloride, 97% (CAS 1269394-33-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A982318-5g |
| cas | 1269394-33-3 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 3969.49 Pln | |
| AmBeed | 1g | 1398.04 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
N,N-dimethyl-1-(3-methylphenyl)ethane-1,2-diamine;dihydrochloride (CAS 1269394-33-3) is a chemical compound with the molecular formula C11H20Cl2N2 and a molecular weight of 251.19 g/mol. IUPAC name: N,N-dimethyl-1-(3-methylphenyl)ethane-1,2-diamine;dihydrochloride. InChIKey: VOSNNWNFBWMPDL-UHFFFAOYSA-N.
| Molecular formula | C11H20Cl2N2 |
|---|---|
| Molecular weight | 251.19 g/mol |
| IUPAC name | N,N-dimethyl-1-(3-methylphenyl)ethane-1,2-diamine;dihydrochloride |
| InChIKey | VOSNNWNFBWMPDL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C(CN)N(C)C.Cl.Cl |
Computed by PubChem (NCBI)