N1,N3-Dibenzylpropane-1,3-diamine, 97%
cas: 10239-34-6 — see every product listed under this CAS number, including other names
N1,N3-Dibenzylpropane-1,3-diamine, 97% (CAS 10239-34-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A138307-1g |
| cas | 10239-34-6 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 125.62 Pln | |
| Ambeed | 5g | 203.50 Pln | |
| Ambeed | 10g | 331.44 Pln | |
| Ambeed | 25g | 442.69 Pln | |
| Ambeed | 100g | 1527.38 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 112.40 Pln | |
| Chemat | 10g | 165.20 Pln | |
| Chemat | 25g | 318.80 Pln | |
| Chemat | 100g | 1096.40 Pln | |
| Chemat | 500g | 5169.60 Pln | |
| BLDpharm | 1g | 125.54 Pln | |
| BLDpharm | 5g | 214.39 Pln | |
| BLDpharm | 10g | 347.68 Pln | |
| BLDpharm | 25g | 469.86 Pln | |
| BLDpharm | 100g | 1641.67 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
N,N'-dibenzylpropane-1,3-diamine (CAS 10239-34-6) is a chemical compound with the molecular formula C17H22N2 and a molecular weight of 254.37 g/mol. IUPAC name: N,N'-dibenzylpropane-1,3-diamine. InChIKey: RXLUOFXICZSZIB-UHFFFAOYSA-N.
| Molecular formula | C17H22N2 |
|---|---|
| Molecular weight | 254.37 g/mol |
| IUPAC name | N,N'-dibenzylpropane-1,3-diamine |
| InChIKey | RXLUOFXICZSZIB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNCCCNCC2=CC=CC=C2 |
Computed by PubChem (NCBI)
Synonyms:
N,N'-Bis(benzyl)-1,3-diaminopropane, N1,N3-Dibenzylpropane-1,3-diamine, N,N'-Dibenzyl-1,3-propanediamine, N,N'-dibenzylpropane-1,3-diamine, 1,3-Propanediamine, N,N'-bis(phenylmethyl)-, n,n'-dibenzyl-1,3-diaminopropane, 1,3-Propanediamine, N1,N3-bis(phenylmethyl)-, N,N-Dibenzyl-1,3-diaminopropane, N,N'-dibenzylpro, N,N\'-Dibenzyl-1,3-Propanediamine
