N,N'-Di(naphthalen-2-yl)-N,N'-diphenylbenzene-1,4-diamine, 99% (CAS 139994-47-1) manufactured by Lumtec in a 1g pack.
| brand | Lumtec |
|---|---|
| catalog number | LT-N143-1g |
| cas | 139994-47-1 |
| size | 1g |
| availability | 12.11.2021: In Stock |
Ask us about this product — we're happy to help.
| purity | 99% |
|---|
1-N,4-N-dinaphthalen-2-yl-1-N,4-N-diphenylbenzene-1,4-diamine (CAS 139994-47-1) is a chemical compound with the molecular formula C38H28N2 and a molecular weight of 512.6 g/mol. IUPAC name: 1-N,4-N-dinaphthalen-2-yl-1-N,4-N-diphenylbenzene-1,4-diamine. InChIKey: QVDYERLGSGAPKP-UHFFFAOYSA-N.
| Molecular formula | C38H28N2 |
|---|---|
| Molecular weight | 512.6 g/mol |
| IUPAC name | 1-N,4-N-dinaphthalen-2-yl-1-N,4-N-diphenylbenzene-1,4-diamine |
| InChIKey | QVDYERLGSGAPKP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N(C2=CC=C(C=C2)N(C3=CC=CC=C3)C4=CC5=CC=CC=C5C=C4)C6=CC7=CC=CC=C7C=C6 |
Computed by PubChem (NCBI)