cas: 5407-57-8 — see every product listed under this CAS number, including other names
N1-(7-Chloroquinolin-4-yl)ethane-1,2-diamine, 97%, 97% (CAS 5407-57-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DGUR-100mg |
| cas | 5407-57-8 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 117.20 Pln | |
| Chemat | 250mg | 146.00 Pln | |
| Chemat | 500mg | 198.80 Pln | |
| Chemat | 1g | 270.80 Pln | |
| Chemat | 5g | 890.00 Pln | |
| Chemat | 10g | 1576.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
N'-(7-chloroquinolin-4-yl)ethane-1,2-diamine (CAS 5407-57-8) is a chemical compound with the molecular formula C11H12ClN3 and a molecular weight of 221.68 g/mol. IUPAC name: N'-(7-chloroquinolin-4-yl)ethane-1,2-diamine. InChIKey: XBDASFGJHWAFFE-UHFFFAOYSA-N.
| Molecular formula | C11H12ClN3 |
|---|---|
| Molecular weight | 221.68 g/mol |
| IUPAC name | N'-(7-chloroquinolin-4-yl)ethane-1,2-diamine |
| InChIKey | XBDASFGJHWAFFE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CN=C2C=C1Cl)NCCN |
Computed by PubChem (NCBI)