CAS 5407-57-8 appears in our catalog under these names: N1-(7-Chloroquinolin-4-yl)ethane-1,2-diamine, 95%, N–(2–aminoethyl)–7–chloroquinolin–4–amine, 4-(2-Aminoethyl)amino-7-chloroquinoline/ 98.53% (existing batch purity), N1-(7-Chloroquinolin-4-yl)ethane-1,2-diamine, 97%, 97%, Antimalarial agent 39, 98.42%. Offered by: Combi-blocks, GLPBio, TargetMol, Chemat, MedChemExpress. Available pack sizes: 250mg, 1g, 5g, 100mg, 25mg, 50mg, 500mg, 10g.
N'-(7-chloroquinolin-4-yl)ethane-1,2-diamine (CAS 5407-57-8) is a chemical compound with the molecular formula C11H12ClN3 and a molecular weight of 221.68 g/mol. IUPAC name: N'-(7-chloroquinolin-4-yl)ethane-1,2-diamine. InChIKey: XBDASFGJHWAFFE-UHFFFAOYSA-N.
| Molecular formula | C11H12ClN3 |
|---|---|
| Molecular weight | 221.68 g/mol |
| IUPAC name | N'-(7-chloroquinolin-4-yl)ethane-1,2-diamine |
| InChIKey | XBDASFGJHWAFFE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CN=C2C=C1Cl)NCCN |
Computed by PubChem (NCBI)