CAS 956356-31-3 is the registry number for 2-Chloro-5-[(3,5-dimethyl-1h-pyrazol-1-yl)methyl]pyridine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-chloro-5-[(3,5-dimethylpyrazol-1-yl)methyl]pyridine (CAS 956356-31-3) is a chemical compound with the molecular formula C11H12ClN3 and a molecular weight of 221.68 g/mol. IUPAC name: 2-chloro-5-[(3,5-dimethylpyrazol-1-yl)methyl]pyridine. InChIKey: BRBWPBUHWRCSJS-UHFFFAOYSA-N.
| Molecular formula | C11H12ClN3 |
|---|---|
| Molecular weight | 221.68 g/mol |
| IUPAC name | 2-chloro-5-[(3,5-dimethylpyrazol-1-yl)methyl]pyridine |
| InChIKey | BRBWPBUHWRCSJS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN1CC2=CN=C(C=C2)Cl)C |
Computed by PubChem (NCBI)