CAS 508219-81-6 appears in our catalog under these names: 5-Hydrazino-2-phenylpyridine hydrochloride, 95%, 5-HYDRAZINO-2-PHENYLPYRIDINE HYDROCHLORIDE, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 250mg, 1g, 100mg, 500mg.
(6-phenyl-3-pyridinyl)hydrazine;hydrochloride (CAS 508219-81-6) is a chemical compound with the molecular formula C11H12ClN3 and a molecular weight of 221.68 g/mol. IUPAC name: (6-phenyl-3-pyridinyl)hydrazine;hydrochloride. InChIKey: RVGGHASHXCXBPX-UHFFFAOYSA-N.
| Molecular formula | C11H12ClN3 |
|---|---|
| Molecular weight | 221.68 g/mol |
| IUPAC name | (6-phenyl-3-pyridinyl)hydrazine;hydrochloride |
| InChIKey | RVGGHASHXCXBPX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC=C(C=C2)NN.Cl |
Computed by PubChem (NCBI)