cas: 579474-47-8 — see every product listed under this CAS number, including other names
N1-(tert-Butoxycarbonyl)-4-fluoro-1,2-phenylenediamine, >98.0%(T) (CAS 579474-47-8) is a chemical reagent available from Chemat. Available pack sizes: 200mg, 1g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | B4236-200MG |
| cas | 579474-47-8 |
| size | 200mg |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 200mg | 138.01 Pln | |
| TCI | 1g | 423.21 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(T) |
Tert-butyl N-(2-amino-4-fluorophenyl)carbamate (CAS 579474-47-8) is a chemical compound with the molecular formula C11H15FN2O2 and a molecular weight of 226.25 g/mol. IUPAC name: tert-butyl N-(2-amino-4-fluorophenyl)carbamate. InChIKey: IBKSOWUYKOORFF-UHFFFAOYSA-N.
| Molecular formula | C11H15FN2O2 |
|---|---|
| Molecular weight | 226.25 g/mol |
| IUPAC name | tert-butyl N-(2-amino-4-fluorophenyl)carbamate |
| InChIKey | IBKSOWUYKOORFF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(C=C(C=C1)F)N |
Computed by PubChem (NCBI)