cas: 579474-47-8 — see every product listed under this CAS number, including other names
tert-Butyl 2-amino-4-fluorophenylcarbamate, 98%, 98% (CAS 579474-47-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EJYJ-100mg |
| cas | 579474-47-8 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 122.00 Pln | |
| Chemat | 250mg | 150.80 Pln | |
| Chemat | 1g | 328.40 Pln | |
| Chemat | 5g | 1202.00 Pln | |
| Chemat | 10g | 2339.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-(2-amino-4-fluorophenyl)carbamate (CAS 579474-47-8) is a chemical compound with the molecular formula C11H15FN2O2 and a molecular weight of 226.25 g/mol. IUPAC name: tert-butyl N-(2-amino-4-fluorophenyl)carbamate. InChIKey: IBKSOWUYKOORFF-UHFFFAOYSA-N.
| Molecular formula | C11H15FN2O2 |
|---|---|
| Molecular weight | 226.25 g/mol |
| IUPAC name | tert-butyl N-(2-amino-4-fluorophenyl)carbamate |
| InChIKey | IBKSOWUYKOORFF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(C=C(C=C1)F)N |
Computed by PubChem (NCBI)