cas: 66845-42-9 — see every product listed under this CAS number, including other names
N6-[(1,1-Dimethylethoxy)carbonyl]-N2-[(phenylmethoxy)carbonyl]-D-lysine, 97%, 97% (CAS 66845-42-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1146SW-250mg |
| cas | 66845-42-9 |
| size | 250mg |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 88.40 Pln | |
| Chemat | 5g | 141.20 Pln | |
| Chemat | 10g | 198.80 Pln | |
| Chemat | 25g | 386.00 Pln | |
| Chemat | 50g | 659.60 Pln | |
| Chemat | 100g | 1149.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2R)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(phenylmethoxycarbonylamino)hexanoic acid (CAS 66845-42-9) is a chemical compound with the molecular formula C19H28N2O6 and a molecular weight of 380.4 g/mol. IUPAC name: (2R)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(phenylmethoxycarbonylamino)hexanoic acid. InChIKey: DYSBKEOCHROEGX-OAHLLOKOSA-N.
| Molecular formula | C19H28N2O6 |
|---|---|
| Molecular weight | 380.4 g/mol |
| IUPAC name | (2R)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(phenylmethoxycarbonylamino)hexanoic acid |
| InChIKey | DYSBKEOCHROEGX-OAHLLOKOSA-N |
| SMILES | CC(C)(C)OC(=O)NCCCC[C@H](C(=O)O)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)